C22H30ClN — CID 142072287
13-chloro-2-heptan-4-yl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene;methane (PubChem CID 142072287) has the molecular formula C22H30ClN and a molecular weight of 343.94 g/mol. Its IUPAC name is 13-chloro-2-heptan-4-yl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene;methane.
| Compound Name | 13-chloro-2-heptan-4-yl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene;methane |
|---|---|
| PubChem CID | 142072287 |
| Molecular Formula | C22H30ClN |
| Molecular Weight | 343.94 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | 13-chloro-2-heptan-4-yl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene;methane |
| SMILES | C.CCCC(CCC)C1c2ccc(Cl)cc2CCc2cccnc21 |
| InChI | InChI=1S/C21H26ClN.CH4/c1-3-6-15(7-4-2)20-19-12-11-18(22)14-17(19)10-9-16-8-5-13-23-21(16)20;/h5,8,11-15,20H,3-4,6-7,9-10H2,1-2H3;1H4 |
| InChIKey | WZGDSTLUQQSDHP-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.94 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |