C6H8FNO — CID 142075000
4-(fluoroamino)cyclohexa-1,5-dien-1-ol (PubChem CID 142075000) has the molecular formula C6H8FNO and a molecular weight of 129.13 g/mol. Its IUPAC name is 4-(fluoroamino)cyclohexa-1,5-dien-1-ol.
| Compound Name | 4-(fluoroamino)cyclohexa-1,5-dien-1-ol |
|---|---|
| PubChem CID | 142075000 |
| Molecular Formula | C6H8FNO |
| Molecular Weight | 129.13 g/mol |
| Exact Mass | 129.06 |
| IUPAC Name | 4-(fluoroamino)cyclohexa-1,5-dien-1-ol |
| SMILES | OC1=CCC(NF)C=C1 |
| InChI | InChI=1S/C6H8FNO/c7-8-5-1-3-6(9)4-2-5/h1,3-5,8-9H,2H2 |
| InChIKey | ZJOKXVMLOHWVRH-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.13 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|