C15H20N2O — CID 142075931
(5E,6Z)-5-ethylidene-4-(2-methylimidazol-1-yl)nona-6,8-dienal (PubChem CID 142075931) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is (5E,6Z)-5-ethylidene-4-(2-methylimidazol-1-yl)nona-6,8-dienal.
| Compound Name | (5E,6Z)-5-ethylidene-4-(2-methylimidazol-1-yl)nona-6,8-dienal |
|---|---|
| PubChem CID | 142075931 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | (5E,6Z)-5-ethylidene-4-(2-methylimidazol-1-yl)nona-6,8-dienal |
| SMILES | C=C/C=C\C(=C/C)C(CCC=O)n1ccnc1C |
| InChI | InChI=1S/C15H20N2O/c1-4-6-8-14(5-2)15(9-7-12-18)17-11-10-16-13(17)3/h4-6,8,10-12,15H,1,7,9H2,2-3H3/b8-6-,14-5+ |
| InChIKey | RWUKUWJEBCOPHD-QIIRRSOFSA-N |
| XLogP | 3.40 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|