About [4-[(E)-2-phenylethenyl]-2-[(E)-3-phenylprop-2-enimidoyl]anilino] thiohypofluorite
[4-[(E)-2-phenylethenyl]-2-[(E)-3-phenylprop-2-enimidoyl]anilino] thiohypofluorite (PubChem CID 142077055) has the molecular formula C23H19FN2S
and a molecular weight of 374.48 g/mol. Its IUPAC name is [4-[(E)-2-phenylethenyl]-2-[(E)-3-phenylprop-2-enimidoyl]anilino] thiohypofluorite.
Molecular Properties
| Compound Name | [4-[(E)-2-phenylethenyl]-2-[(E)-3-phenylprop-2-enimidoyl]anilino] thiohypofluorite |
| PubChem CID | 142077055 |
| Molecular Formula | C23H19FN2S |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | [4-[(E)-2-phenylethenyl]-2-[(E)-3-phenylprop-2-enimidoyl]anilino] thiohypofluorite |
| SMILES | [H]/N=C(\C=C\c1ccccc1)c1cc(/C=C/c2ccccc2)ccc1NSF |
| InChI | InChI=1S/C23H19FN2S/c24-27-26-23-16-14-20(12-11-18-7-3-1-4-8-18)17-21(23)22(25)15-13-19-9-5-2-6-10-19/h1-17,25-26H/b12-11+,15-13+,25-22+ |
| InChIKey | RFCYWBVZSVNMSU-WAUXFUDWSA-N |
| XLogP | 6.88 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [4-[(E)-2-phenylethenyl]-2-[(E)-3-phenylprop-2-enimidoyl]anilino] thiohypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(E)-2-phenylethenyl]-2-[(E)-3-phenylprop-2-enimidoyl]anilino] thiohypofluorite?
The IUPAC name of [4-[(E)-2-phenylethenyl]-2-[(E)-3-phenylprop-2-enimidoyl]anilino] thiohypofluorite (CID 142077055) is [4-[(E)-2-phenylethenyl]-2-[(E)-3-phenylprop-2-enimidoyl]anilino] thiohypofluorite.
What is the SMILES notation for [4-[(E)-2-phenylethenyl]-2-[(E)-3-phenylprop-2-enimidoyl]anilino] thiohypofluorite?
The canonical SMILES for [4-[(E)-2-phenylethenyl]-2-[(E)-3-phenylprop-2-enimidoyl]anilino] thiohypofluorite is [H]/N=C(\C=C\c1ccccc1)c1cc(/C=C/c2ccccc2)ccc1NSF.
What is the InChIKey of [4-[(E)-2-phenylethenyl]-2-[(E)-3-phenylprop-2-enimidoyl]anilino] thiohypofluorite?
The InChIKey is RFCYWBVZSVNMSU-WAUXFUDWSA-N. The full InChI is InChI=1S/C23H19FN2S/c24-27-26-23-16-14-20(12-11-18-7-3-1-4-8-18)17-21(23)22(25)15-13-19-9-5-2-6-10-19/h1-17,25-26H/b12-11+,15-13+,25-22+.
What are the key properties of [4-[(E)-2-phenylethenyl]-2-[(E)-3-phenylprop-2-enimidoyl]anilino] thiohypofluorite?
[4-[(E)-2-phenylethenyl]-2-[(E)-3-phenylprop-2-enimidoyl]anilino] thiohypofluorite has a molecular weight of 374.48 g/mol, XLogP of 6.88, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(E)-2-phenylethenyl]-2-[(E)-3-phenylprop-2-enimidoyl]anilino] thiohypofluorite is sourced from PubChem (CID 142077055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).