C27H30FN3OS — CID 142077100
[4-[(3E,5Z,6E)-5-ethylidene-8-hydroxy-4-methylocta-1,3,6-trien-3-yl]-2-[2-(2-methylanilino)prop-2-enimidoyl]anilino] thiohypofluorite (PubChem CID 142077100) has the molecular formula C27H30FN3OS and a molecular weight of 463.62 g/mol. Its IUPAC name is [4-[(3E,5Z,6E)-5-ethylidene-8-hydroxy-4-methylocta-1,3,6-trien-3-yl]-2-[2-(2-methylanilino)prop-2-enimidoyl]anilino] thiohypofluorite.
| Compound Name | [4-[(3E,5Z,6E)-5-ethylidene-8-hydroxy-4-methylocta-1,3,6-trien-3-yl]-2-[2-(2-methylanilino)prop-2-enimidoyl]anilino] thiohypofluorite |
|---|---|
| PubChem CID | 142077100 |
| Molecular Formula | C27H30FN3OS |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | [4-[(3E,5Z,6E)-5-ethylidene-8-hydroxy-4-methylocta-1,3,6-trien-3-yl]-2-[2-(2-methylanilino)prop-2-enimidoyl]anilino] thiohypofluorite |
| SMILES | [H]/N=C(\C(=C)Nc1ccccc1C)c1cc(/C(C=C)=C(C)/C(=C\C)/C=C/CO)ccc1NSF |
| InChI | InChI=1S/C27H30FN3OS/c1-6-21(12-10-16-32)19(4)23(7-2)22-14-15-26(31-33-28)24(17-22)27(29)20(5)30-25-13-9-8-11-18(25)3/h6-15,17,29-32H,2,5,16H2,1,3-4H3/b12-10+,21-6-,23-19+,29-27+ |
| InChIKey | PZSJKWIYWNIGRN-OCOFOGTJSA-N |
| XLogP | 7.39 |
| TPSA | 68.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|