C14H18N2O — CID 142078824
1-(4-methylphenyl)-5-prop-2-enyl-1,3-diazinan-2-one (PubChem CID 142078824) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is 1-(4-methylphenyl)-5-prop-2-enyl-1,3-diazinan-2-one.
| Compound Name | 1-(4-methylphenyl)-5-prop-2-enyl-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 142078824 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 1-(4-methylphenyl)-5-prop-2-enyl-1,3-diazinan-2-one |
| SMILES | C=CCC1CNC(=O)N(c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C14H18N2O/c1-3-4-12-9-15-14(17)16(10-12)13-7-5-11(2)6-8-13/h3,5-8,12H,1,4,9-10H2,2H3,(H,15,17) |
| InChIKey | PYIPXDAHRUGZPL-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|