About 2-[[(2S)-butan-2-yl]-(3-methylsulfanylpropyl)amino]ethanethiol;methane
2-[[(2S)-butan-2-yl]-(3-methylsulfanylpropyl)amino]ethanethiol;methane (PubChem CID 142079258) has the molecular formula C11H27NS2
and a molecular weight of 237.48 g/mol. Its IUPAC name is 2-[[(2S)-butan-2-yl]-(3-methylsulfanylpropyl)amino]ethanethiol;methane.
Molecular Properties
| Compound Name | 2-[[(2S)-butan-2-yl]-(3-methylsulfanylpropyl)amino]ethanethiol;methane |
| PubChem CID | 142079258 |
| Molecular Formula | C11H27NS2 |
| Molecular Weight | 237.48 g/mol |
| Exact Mass | 237.16 |
| IUPAC Name | 2-[[(2S)-butan-2-yl]-(3-methylsulfanylpropyl)amino]ethanethiol;methane |
| SMILES | C.CC[C@H](C)N(CCS)CCCSC |
| InChI | InChI=1S/C10H23NS2.CH4/c1-4-10(2)11(7-8-12)6-5-9-13-3;/h10,12H,4-9H2,1-3H3;1H4/t10-;/m0./s1 |
| InChIKey | RBCKFLGECHONON-PPHPATTJSA-N |
| XLogP | 3.41 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.48 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[[(2S)-butan-2-yl]-(3-methylsulfanylpropyl)amino]ethanethiol;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(2S)-butan-2-yl]-(3-methylsulfanylpropyl)amino]ethanethiol;methane?
The IUPAC name of 2-[[(2S)-butan-2-yl]-(3-methylsulfanylpropyl)amino]ethanethiol;methane (CID 142079258) is 2-[[(2S)-butan-2-yl]-(3-methylsulfanylpropyl)amino]ethanethiol;methane.
What is the SMILES notation for 2-[[(2S)-butan-2-yl]-(3-methylsulfanylpropyl)amino]ethanethiol;methane?
The canonical SMILES for 2-[[(2S)-butan-2-yl]-(3-methylsulfanylpropyl)amino]ethanethiol;methane is C.CC[C@H](C)N(CCS)CCCSC.
What is the InChIKey of 2-[[(2S)-butan-2-yl]-(3-methylsulfanylpropyl)amino]ethanethiol;methane?
The InChIKey is RBCKFLGECHONON-PPHPATTJSA-N. The full InChI is InChI=1S/C10H23NS2.CH4/c1-4-10(2)11(7-8-12)6-5-9-13-3;/h10,12H,4-9H2,1-3H3;1H4/t10-;/m0./s1.
What are the key properties of 2-[[(2S)-butan-2-yl]-(3-methylsulfanylpropyl)amino]ethanethiol;methane?
2-[[(2S)-butan-2-yl]-(3-methylsulfanylpropyl)amino]ethanethiol;methane has a molecular weight of 237.48 g/mol, XLogP of 3.41, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(2S)-butan-2-yl]-(3-methylsulfanylpropyl)amino]ethanethiol;methane is sourced from PubChem (CID 142079258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).