C52H31ClN2O7 — CID 142079921
5-chloro-3-(3-hydroxy-2,7-dinaphthalen-2-yl-6-oxo-4,5-dipyridin-2-ylxanthen-9-yl)-2-methylterephthalic acid (PubChem CID 142079921) has the molecular formula C52H31ClN2O7 and a molecular weight of 831.28 g/mol. Its IUPAC name is 5-chloro-3-(3-hydroxy-2,7-dinaphthalen-2-yl-6-oxo-4,5-dipyridin-2-ylxanthen-9-yl)-2-methylterephthalic acid.
| Compound Name | 5-chloro-3-(3-hydroxy-2,7-dinaphthalen-2-yl-6-oxo-4,5-dipyridin-2-ylxanthen-9-yl)-2-methylterephthalic acid |
|---|---|
| PubChem CID | 142079921 |
| Molecular Formula | C52H31ClN2O7 |
| Molecular Weight | 831.28 g/mol |
| Exact Mass | 830.18 |
| IUPAC Name | 5-chloro-3-(3-hydroxy-2,7-dinaphthalen-2-yl-6-oxo-4,5-dipyridin-2-ylxanthen-9-yl)-2-methylterephthalic acid |
| SMILES | Cc1c(C(=O)O)cc(Cl)c(C(=O)O)c1-c1c2cc(-c3ccc4ccccc4c3)c(=O)c(-c3ccccn3)c-2oc2c(-c3ccccn3)c(O)c(-c3ccc4ccccc4c3)cc12 |
| InChI | InChI=1S/C52H31ClN2O7/c1-27-34(51(58)59)26-39(53)44(52(60)61)42(27)43-37-24-35(32-18-16-28-10-2-4-12-30(28)22-32)47(56)45(40-14-6-8-20-54-40)49(37)62-50-38(43)25-36(48(57)46(50)41-15-7-9-21-55-41)33-19-17-29-11-3-5-13-31(29)23-33/h2-26,56H,1H3,(H,58,59)(H,60,61) |
| InChIKey | YVLJDCWQZGQUPI-UHFFFAOYSA-N |
| XLogP | 12.39 |
| TPSA | 150.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.28 |
| LogP ≤ 5 | 12.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|