C37H22Cl2FNO7 — CID 20648413
2,5-dichloro-4-(dihydroxymethyl)-3-[6-fluoro-9-hydroxy-8-(2-methylphenyl)-5-oxo-10-pyridin-3-ylbenzo[a]xanthen-12-yl]benzoic acid (PubChem CID 20648413) has the molecular formula C37H22Cl2FNO7 and a molecular weight of 682.49 g/mol. Its IUPAC name is 2,5-dichloro-4-(dihydroxymethyl)-3-[6-fluoro-9-hydroxy-8-(2-methylphenyl)-5-oxo-10-pyridin-3-ylbenzo[a]xanthen-12-yl]benzoic acid.
| Compound Name | 2,5-dichloro-4-(dihydroxymethyl)-3-[6-fluoro-9-hydroxy-8-(2-methylphenyl)-5-oxo-10-pyridin-3-ylbenzo[a]xanthen-12-yl]benzoic acid |
|---|---|
| PubChem CID | 20648413 |
| Molecular Formula | C37H22Cl2FNO7 |
| Molecular Weight | 682.49 g/mol |
| Exact Mass | 681.08 |
| IUPAC Name | 2,5-dichloro-4-(dihydroxymethyl)-3-[6-fluoro-9-hydroxy-8-(2-methylphenyl)-5-oxo-10-pyridin-3-ylbenzo[a]xanthen-12-yl]benzoic acid |
| SMILES | Cc1ccccc1-c1c(O)c(-c2cccnc2)cc2c(-c3c(Cl)c(C(=O)O)cc(Cl)c3C(O)O)c3c4ccccc4c(=O)c(F)c-3oc12 |
| InChI | InChI=1S/C37H22Cl2FNO7/c1-16-7-2-3-9-18(16)27-32(42)21(17-8-6-12-41-15-17)13-22-25(29-28(37(46)47)24(38)14-23(30(29)39)36(44)45)26-19-10-4-5-11-20(19)33(43)31(40)35(26)48-34(22)27/h2-15,37,42,46-47H,1H3,(H,44,45) |
| InChIKey | VTTKBBHNZLTEJK-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 141.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.49 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|