C31H18Cl2N2O7 — CID 20648402
2,5-dichloro-4-(dihydroxymethyl)-3-(3-hydroxy-6-oxo-2,7-dipyridin-3-ylxanthen-9-yl)benzoic acid (PubChem CID 20648402) has the molecular formula C31H18Cl2N2O7 and a molecular weight of 601.40 g/mol. Its IUPAC name is 2,5-dichloro-4-(dihydroxymethyl)-3-(3-hydroxy-6-oxo-2,7-dipyridin-3-ylxanthen-9-yl)benzoic acid.
| Compound Name | 2,5-dichloro-4-(dihydroxymethyl)-3-(3-hydroxy-6-oxo-2,7-dipyridin-3-ylxanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 20648402 |
| Molecular Formula | C31H18Cl2N2O7 |
| Molecular Weight | 601.40 g/mol |
| Exact Mass | 600.05 |
| IUPAC Name | 2,5-dichloro-4-(dihydroxymethyl)-3-(3-hydroxy-6-oxo-2,7-dipyridin-3-ylxanthen-9-yl)benzoic acid |
| SMILES | O=C(O)c1cc(Cl)c(C(O)O)c(-c2c3cc(-c4cccnc4)c(=O)cc-3oc3cc(O)c(-c4cccnc4)cc23)c1Cl |
| InChI | InChI=1S/C31H18Cl2N2O7/c32-21-9-20(30(38)39)29(33)28(27(21)31(40)41)26-18-7-16(14-3-1-5-34-12-14)22(36)10-24(18)42-25-11-23(37)17(8-19(25)26)15-4-2-6-35-13-15/h1-13,31,36,40-41H,(H,38,39) |
| InChIKey | XEWUZBVPYMHXCX-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 153.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.40 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|