C43H24Cl2N2O7 — CID 9896899
2,5-Dichloro-3-(3-hydroxy-6-oxo-2,7-diphenyl-4,5-dipyridin-3-ylxanthen-9-yl)terephthalic acid (PubChem CID 9896899) has the molecular formula C43H24Cl2N2O7 and a molecular weight of 751.60 g/mol. Its IUPAC name is 2,5-dichloro-3-(3-hydroxy-6-oxo-2,7-diphenyl-4,5-dipyridin-3-ylxanthen-9-yl)terephthalic acid.
| Compound Name | 2,5-Dichloro-3-(3-hydroxy-6-oxo-2,7-diphenyl-4,5-dipyridin-3-ylxanthen-9-yl)terephthalic acid |
|---|---|
| PubChem CID | 9896899 |
| Molecular Formula | C43H24Cl2N2O7 |
| Molecular Weight | 751.60 g/mol |
| Exact Mass | 750.10 |
| IUPAC Name | 2,5-dichloro-3-(3-hydroxy-6-oxo-2,7-diphenyl-4,5-dipyridin-3-ylxanthen-9-yl)terephthalic acid |
| SMILES | C1=CC=C(C=C1)C2=CC3=C(C4=CC(=C(C(=C4OC3=C(C2=O)C5=CN=CC=C5)C6=CN=CC=C6)O)C7=CC=CC=C7)C8=C(C(=CC(=C8C(=O)O)Cl)C(=O)O)Cl |
| InChI | InChI=1S/C43H24Cl2N2O7/c44-31-19-30(42(50)51)37(45)36(35(31)43(52)53)34-28-17-26(22-9-3-1-4-10-22)38(48)32(24-13-7-15-46-20-24)40(28)54-41-29(34)18-27(23-11-5-2-6-12-23)39(49)33(41)25-14-8-16-47-21-25/h1-21,48H,(H,50,51)(H,52,53) |
| InChIKey | FCWZALZRTCULMY-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 147.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | 1550 |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.60 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|