C36H22Cl2FNO3 — CID 142079922
12-(2,5-dichloro-3-methylphenyl)-6-fluoro-9-hydroxy-8-(2-methylphenyl)-10-pyridin-3-ylbenzo[a]xanthen-5-one (PubChem CID 142079922) has the molecular formula C36H22Cl2FNO3 and a molecular weight of 606.48 g/mol. Its IUPAC name is 12-(2,5-dichloro-3-methylphenyl)-6-fluoro-9-hydroxy-8-(2-methylphenyl)-10-pyridin-3-ylbenzo[a]xanthen-5-one.
| Compound Name | 12-(2,5-dichloro-3-methylphenyl)-6-fluoro-9-hydroxy-8-(2-methylphenyl)-10-pyridin-3-ylbenzo[a]xanthen-5-one |
|---|---|
| PubChem CID | 142079922 |
| Molecular Formula | C36H22Cl2FNO3 |
| Molecular Weight | 606.48 g/mol |
| Exact Mass | 605.10 |
| IUPAC Name | 12-(2,5-dichloro-3-methylphenyl)-6-fluoro-9-hydroxy-8-(2-methylphenyl)-10-pyridin-3-ylbenzo[a]xanthen-5-one |
| SMILES | Cc1ccccc1-c1c(O)c(-c2cccnc2)cc2c(-c3cc(Cl)cc(C)c3Cl)c3c4ccccc4c(=O)c(F)c-3oc12 |
| InChI | InChI=1S/C36H22Cl2FNO3/c1-18-8-3-4-10-22(18)30-33(41)25(20-9-7-13-40-17-20)16-27-28(26-15-21(37)14-19(2)31(26)38)29-23-11-5-6-12-24(23)34(42)32(39)36(29)43-35(27)30/h3-17,41H,1-2H3 |
| InChIKey | LGDRXKXZIMNDNL-UHFFFAOYSA-N |
| XLogP | 10.22 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.48 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|