C17H30N2 — CID 142081744
3-tert-butyl-1-N,2-N-dimethyl-6-propan-2-ylcyclohexa-3,5-diene-1,2-diimine;ethane (PubChem CID 142081744) has the molecular formula C17H30N2 and a molecular weight of 262.44 g/mol. Its IUPAC name is 3-tert-butyl-1-N,2-N-dimethyl-6-propan-2-ylcyclohexa-3,5-diene-1,2-diimine;ethane.
| Compound Name | 3-tert-butyl-1-N,2-N-dimethyl-6-propan-2-ylcyclohexa-3,5-diene-1,2-diimine;ethane |
|---|---|
| PubChem CID | 142081744 |
| Molecular Formula | C17H30N2 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.24 |
| IUPAC Name | 3-tert-butyl-1-N,2-N-dimethyl-6-propan-2-ylcyclohexa-3,5-diene-1,2-diimine;ethane |
| SMILES | C/N=C1/C(C(C)(C)C)=CC=C(C(C)C)/C1=N\C.CC |
| InChI | InChI=1S/C15H24N2.C2H6/c1-10(2)11-8-9-12(15(3,4)5)14(17-7)13(11)16-6;1-2/h8-10H,1-7H3;1-2H3/b16-13+,17-14-; |
| InChIKey | JARVFUKQEDDUOR-WZOXMJQNSA-N |
| XLogP | 4.72 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|