C17H23N3O — CID 142084222
1-N-(anilinomethyl)-3-N-(ethoxymethyl)-4-methylbenzene-1,3-diamine (PubChem CID 142084222) has the molecular formula C17H23N3O and a molecular weight of 285.39 g/mol. Its IUPAC name is 1-N-(anilinomethyl)-3-N-(ethoxymethyl)-4-methylbenzene-1,3-diamine.
| Compound Name | 1-N-(anilinomethyl)-3-N-(ethoxymethyl)-4-methylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 142084222 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | 1-N-(anilinomethyl)-3-N-(ethoxymethyl)-4-methylbenzene-1,3-diamine |
| SMILES | CCOCNc1cc(NCNc2ccccc2)ccc1C |
| InChI | InChI=1S/C17H23N3O/c1-3-21-13-20-17-11-16(10-9-14(17)2)19-12-18-15-7-5-4-6-8-15/h4-11,18-20H,3,12-13H2,1-2H3 |
| InChIKey | QTNQZLMQKRDWRR-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 45.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|