C16H23N3O — CID 142084213
1-N-[[[(3E)-hexa-1,3,5-trien-3-yl]amino]methyl]-3-N-(methoxymethyl)-4-methylbenzene-1,3-diamine (PubChem CID 142084213) has the molecular formula C16H23N3O and a molecular weight of 273.38 g/mol. Its IUPAC name is 1-N-[[[(3E)-hexa-1,3,5-trien-3-yl]amino]methyl]-3-N-(methoxymethyl)-4-methylbenzene-1,3-diamine.
| Compound Name | 1-N-[[[(3E)-hexa-1,3,5-trien-3-yl]amino]methyl]-3-N-(methoxymethyl)-4-methylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 142084213 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | 1-N-[[[(3E)-hexa-1,3,5-trien-3-yl]amino]methyl]-3-N-(methoxymethyl)-4-methylbenzene-1,3-diamine |
| SMILES | C=C/C=C(\C=C)NCNc1ccc(C)c(NCOC)c1 |
| InChI | InChI=1S/C16H23N3O/c1-5-7-14(6-2)17-11-18-15-9-8-13(3)16(10-15)19-12-20-4/h5-10,17-19H,1-2,11-12H2,3-4H3/b14-7+ |
| InChIKey | SVXKLIHNEWNOTF-VGOFMYFVSA-N |
| XLogP | 3.23 |
| TPSA | 45.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|