C19H17Br2N3O4 — CID 142086272
2-[3,5-dibromo-4-[1-[(dimethylamino)methyl]indol-5-yl]oxyanilino]-2-oxoacetic acid (PubChem CID 142086272) has the molecular formula C19H17Br2N3O4 and a molecular weight of 511.17 g/mol. Its IUPAC name is 2-[3,5-dibromo-4-[1-[(dimethylamino)methyl]indol-5-yl]oxyanilino]-2-oxoacetic acid.
| Compound Name | 2-[3,5-dibromo-4-[1-[(dimethylamino)methyl]indol-5-yl]oxyanilino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 142086272 |
| Molecular Formula | C19H17Br2N3O4 |
| Molecular Weight | 511.17 g/mol |
| Exact Mass | 508.96 |
| IUPAC Name | 2-[3,5-dibromo-4-[1-[(dimethylamino)methyl]indol-5-yl]oxyanilino]-2-oxoacetic acid |
| SMILES | CN(C)Cn1ccc2cc(Oc3c(Br)cc(NC(=O)C(=O)O)cc3Br)ccc21 |
| InChI | InChI=1S/C19H17Br2N3O4/c1-23(2)10-24-6-5-11-7-13(3-4-16(11)24)28-17-14(20)8-12(9-15(17)21)22-18(25)19(26)27/h3-9H,10H2,1-2H3,(H,22,25)(H,26,27) |
| InChIKey | WVCUIVCAGHDEBU-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.17 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|