C19H18Br2N2O5 — CID 154239778
N-[[3,5-dibromo-4-(4-methoxyphenoxy)phenyl]carbamoyl]-3-ethoxyprop-2-enamide (PubChem CID 154239778) has the molecular formula C19H18Br2N2O5 and a molecular weight of 514.17 g/mol. Its IUPAC name is N-[[3,5-dibromo-4-(4-methoxyphenoxy)phenyl]carbamoyl]-3-ethoxyprop-2-enamide.
| Compound Name | N-[[3,5-dibromo-4-(4-methoxyphenoxy)phenyl]carbamoyl]-3-ethoxyprop-2-enamide |
|---|---|
| PubChem CID | 154239778 |
| Molecular Formula | C19H18Br2N2O5 |
| Molecular Weight | 514.17 g/mol |
| Exact Mass | 511.96 |
| IUPAC Name | N-[[3,5-dibromo-4-(4-methoxyphenoxy)phenyl]carbamoyl]-3-ethoxyprop-2-enamide |
| SMILES | CCOC=CC(=O)NC(=O)Nc1cc(Br)c(Oc2ccc(OC)cc2)c(Br)c1 |
| InChI | InChI=1S/C19H18Br2N2O5/c1-3-27-9-8-17(24)23-19(25)22-12-10-15(20)18(16(21)11-12)28-14-6-4-13(26-2)5-7-14/h4-11H,3H2,1-2H3,(H2,22,23,24,25) |
| InChIKey | CCJRZOOTGREBBC-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.17 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|