C40H76 — CID 142091883
3,5-diethyl-8,9-bis(prop-1-en-2-yl)tricyclo[5.2.1.02,6]decane;ethane;bis(1-ethyl-1-methylcyclopentane) (PubChem CID 142091883) has the molecular formula C40H76 and a molecular weight of 557.05 g/mol. Its IUPAC name is 3,5-diethyl-8,9-bis(prop-1-en-2-yl)tricyclo[5.2.1.02,6]decane;ethane;bis(1-ethyl-1-methylcyclopentane).
| Compound Name | 3,5-diethyl-8,9-bis(prop-1-en-2-yl)tricyclo[5.2.1.02,6]decane;ethane;bis(1-ethyl-1-methylcyclopentane) |
|---|---|
| PubChem CID | 142091883 |
| Molecular Formula | C40H76 |
| Molecular Weight | 557.05 g/mol |
| Exact Mass | 556.59 |
| IUPAC Name | 3,5-diethyl-8,9-bis(prop-1-en-2-yl)tricyclo[5.2.1.02,6]decane;ethane;bis(1-ethyl-1-methylcyclopentane) |
| SMILES | C=C(C)C1C2CC(C1C(=C)C)C1C(CC)CC(CC)C21.CC.CC.CCC1(C)CCCC1.CCC1(C)CCCC1 |
| InChI | InChI=1S/C20H32.2C8H16.2C2H6/c1-7-13-9-14(8-2)20-16-10-15(19(13)20)17(11(3)4)18(16)12(5)6;2*1-3-8(2)6-4-5-7-8;2*1-2/h13-20H,3,5,7-10H2,1-2,4,6H3;2*3-7H2,1-2H3;2*1-2H3 |
| InChIKey | CIZZVMACWCXOQI-UHFFFAOYSA-N |
| XLogP | 13.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.05 |
| LogP ≤ 5 | 13.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|