C13H23N — CID 142094935
(3E,4Z)-3,4-di(ethylidene)pyridine;ethane (PubChem CID 142094935) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is (3E,4Z)-3,4-di(ethylidene)pyridine;ethane.
| Compound Name | (3E,4Z)-3,4-di(ethylidene)pyridine;ethane |
|---|---|
| PubChem CID | 142094935 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | (3E,4Z)-3,4-di(ethylidene)pyridine;ethane |
| SMILES | C/C=c1/ccnc/c1=C/C.CC.CC |
| InChI | InChI=1S/C9H11N.2C2H6/c1-3-8-5-6-10-7-9(8)4-2;2*1-2/h3-7H,1-2H3;2*1-2H3/b8-3-,9-4-;; |
| InChIKey | LRJRJSIMZNIDEZ-DKKFFLFYSA-N |
| XLogP | 2.73 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |