C14H19N3O3S — CID 14209532
N-[2-[3-[2-(methanesulfonamido)ethyl]-1H-indol-5-yl]ethyl]formamide (PubChem CID 14209532) has the molecular formula C14H19N3O3S and a molecular weight of 309.39 g/mol. Its IUPAC name is N-[2-[3-[2-(methanesulfonamido)ethyl]-1H-indol-5-yl]ethyl]formamide.
| Compound Name | N-[2-[3-[2-(methanesulfonamido)ethyl]-1H-indol-5-yl]ethyl]formamide |
|---|---|
| PubChem CID | 14209532 |
| Molecular Formula | C14H19N3O3S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | N-[2-[3-[2-(methanesulfonamido)ethyl]-1H-indol-5-yl]ethyl]formamide |
| SMILES | CS(=O)(=O)NCCc1c[nH]c2ccc(CCNC=O)cc12 |
| InChI | InChI=1S/C14H19N3O3S/c1-21(19,20)17-7-5-12-9-16-14-3-2-11(8-13(12)14)4-6-15-10-18/h2-3,8-10,16-17H,4-7H2,1H3,(H,15,18) |
| InChIKey | GTPBMXDNEBCELO-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|