C21H24F3N3O6S — CID 142096275
N-hydroxy-2,3-dimethoxy-6-[4-[[4-(trifluoromethoxy)phenyl]methyl]piperazin-1-yl]sulfinylbenzamide (PubChem CID 142096275) has the molecular formula C21H24F3N3O6S and a molecular weight of 503.50 g/mol. Its IUPAC name is N-hydroxy-2,3-dimethoxy-6-[4-[[4-(trifluoromethoxy)phenyl]methyl]piperazin-1-yl]sulfinylbenzamide.
| Compound Name | N-hydroxy-2,3-dimethoxy-6-[4-[[4-(trifluoromethoxy)phenyl]methyl]piperazin-1-yl]sulfinylbenzamide |
|---|---|
| PubChem CID | 142096275 |
| Molecular Formula | C21H24F3N3O6S |
| Molecular Weight | 503.50 g/mol |
| Exact Mass | 503.13 |
| IUPAC Name | N-hydroxy-2,3-dimethoxy-6-[4-[[4-(trifluoromethoxy)phenyl]methyl]piperazin-1-yl]sulfinylbenzamide |
| SMILES | COc1ccc(S(=O)N2CCN(Cc3ccc(OC(F)(F)F)cc3)CC2)c(C(=O)NO)c1OC |
| InChI | InChI=1S/C21H24F3N3O6S/c1-31-16-7-8-17(18(19(16)32-2)20(28)25-29)34(30)27-11-9-26(10-12-27)13-14-3-5-15(6-4-14)33-21(22,23)24/h3-8,29H,9-13H2,1-2H3,(H,25,28) |
| InChIKey | ZZXYCZMIOOKZGL-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 100.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.50 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|