C28H43NO — CID 142098372
(3-cyclohexylphenyl)methanamine;ethane;(E)-3-(3-ethylphenyl)prop-2-enal (PubChem CID 142098372) has the molecular formula C28H43NO and a molecular weight of 409.66 g/mol. Its IUPAC name is (3-cyclohexylphenyl)methanamine;ethane;(E)-3-(3-ethylphenyl)prop-2-enal.
| Compound Name | (3-cyclohexylphenyl)methanamine;ethane;(E)-3-(3-ethylphenyl)prop-2-enal |
|---|---|
| PubChem CID | 142098372 |
| Molecular Formula | C28H43NO |
| Molecular Weight | 409.66 g/mol |
| Exact Mass | 409.33 |
| IUPAC Name | (3-cyclohexylphenyl)methanamine;ethane;(E)-3-(3-ethylphenyl)prop-2-enal |
| SMILES | CC.CC.CCc1cccc(/C=C/C=O)c1.NCc1cccc(C2CCCCC2)c1 |
| InChI | InChI=1S/C13H19N.C11H12O.2C2H6/c14-10-11-5-4-8-13(9-11)12-6-2-1-3-7-12;1-2-10-5-3-6-11(9-10)7-4-8-12;2*1-2/h4-5,8-9,12H,1-3,6-7,10,14H2;3-9H,2H2,1H3;2*1-2H3/b;7-4+;; |
| InChIKey | QYYBARGRXBALJZ-SYVOYJLJSA-N |
| XLogP | 7.71 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.66 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|