C21H30N2OS — CID 142099231
N-phenyl-N-[[1-[(2Z)-2-sulfanylpenta-2,4-dienyl]azepan-3-yl]methyl]propanamide (PubChem CID 142099231) has the molecular formula C21H30N2OS and a molecular weight of 358.55 g/mol. Its IUPAC name is N-phenyl-N-[[1-[(2Z)-2-sulfanylpenta-2,4-dienyl]azepan-3-yl]methyl]propanamide.
| Compound Name | N-phenyl-N-[[1-[(2Z)-2-sulfanylpenta-2,4-dienyl]azepan-3-yl]methyl]propanamide |
|---|---|
| PubChem CID | 142099231 |
| Molecular Formula | C21H30N2OS |
| Molecular Weight | 358.55 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | N-phenyl-N-[[1-[(2Z)-2-sulfanylpenta-2,4-dienyl]azepan-3-yl]methyl]propanamide |
| SMILES | C=C/C=C(\S)CN1CCCCC(CN(C(=O)CC)c2ccccc2)C1 |
| InChI | InChI=1S/C21H30N2OS/c1-3-10-20(25)17-22-14-9-8-11-18(15-22)16-23(21(24)4-2)19-12-6-5-7-13-19/h3,5-7,10,12-13,18,25H,1,4,8-9,11,14-17H2,2H3/b20-10- |
| InChIKey | YHUHTEZPJHYCRT-JMIUGGIZSA-N |
| XLogP | 4.53 |
| TPSA | 23.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.55 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|