C25H35N3O — CID 57086462
N-phenyl-N-[[1-[(2-phenylethylamino)methyl]azepan-3-yl]methyl]propanamide (PubChem CID 57086462) has the molecular formula C25H35N3O and a molecular weight of 393.57 g/mol. Its IUPAC name is N-phenyl-N-[[1-[(2-phenylethylamino)methyl]azepan-3-yl]methyl]propanamide.
| Compound Name | N-phenyl-N-[[1-[(2-phenylethylamino)methyl]azepan-3-yl]methyl]propanamide |
|---|---|
| PubChem CID | 57086462 |
| Molecular Formula | C25H35N3O |
| Molecular Weight | 393.57 g/mol |
| Exact Mass | 393.28 |
| IUPAC Name | N-phenyl-N-[[1-[(2-phenylethylamino)methyl]azepan-3-yl]methyl]propanamide |
| SMILES | CCC(=O)N(CC1CCCCN(CNCCc2ccccc2)C1)c1ccccc1 |
| InChI | InChI=1S/C25H35N3O/c1-2-25(29)28(24-14-7-4-8-15-24)20-23-13-9-10-18-27(19-23)21-26-17-16-22-11-5-3-6-12-22/h3-8,11-12,14-15,23,26H,2,9-10,13,16-21H2,1H3 |
| InChIKey | MGDTZCGYWJMZNJ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.57 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|