C26H34N2O3 — CID 20598068
[1-phenyl-2-[3-[(N-propanoylanilino)methyl]piperidin-1-yl]ethyl] propanoate (PubChem CID 20598068) has the molecular formula C26H34N2O3 and a molecular weight of 422.57 g/mol. Its IUPAC name is [1-phenyl-2-[3-[(N-propanoylanilino)methyl]piperidin-1-yl]ethyl] propanoate.
| Compound Name | [1-phenyl-2-[3-[(N-propanoylanilino)methyl]piperidin-1-yl]ethyl] propanoate |
|---|---|
| PubChem CID | 20598068 |
| Molecular Formula | C26H34N2O3 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | [1-phenyl-2-[3-[(N-propanoylanilino)methyl]piperidin-1-yl]ethyl] propanoate |
| SMILES | CCC(=O)OC(CN1CCCC(CN(C(=O)CC)c2ccccc2)C1)c1ccccc1 |
| InChI | InChI=1S/C26H34N2O3/c1-3-25(29)28(23-15-9-6-10-16-23)19-21-12-11-17-27(18-21)20-24(31-26(30)4-2)22-13-7-5-8-14-22/h5-10,13-16,21,24H,3-4,11-12,17-20H2,1-2H3 |
| InChIKey | FJZLVSZAFVBEEX-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |