C9H15N3O5 — CID 142099538
1-[[(3R)-3,4-dihydroxybutan-2-yl]oxyamino]-5-methylpyrimidine-2,4-dione (PubChem CID 142099538) has the molecular formula C9H15N3O5 and a molecular weight of 245.23 g/mol. Its IUPAC name is 1-[[(3R)-3,4-dihydroxybutan-2-yl]oxyamino]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[[(3R)-3,4-dihydroxybutan-2-yl]oxyamino]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 142099538 |
| Molecular Formula | C9H15N3O5 |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 1-[[(3R)-3,4-dihydroxybutan-2-yl]oxyamino]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn(NOC(C)[C@H](O)CO)c(=O)[nH]c1=O |
| InChI | InChI=1S/C9H15N3O5/c1-5-3-12(9(16)10-8(5)15)11-17-6(2)7(14)4-13/h3,6-7,11,13-14H,4H2,1-2H3,(H,10,15,16)/t6?,7-/m1/s1 |
| InChIKey | DDWYFROKVFISQS-COBSHVIPSA-N |
| XLogP | -1.94 |
| TPSA | 116.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|