C12H15N — CID 142100903
(1Z)-N-[(4-methylphenyl)methyl]buta-1,3-dien-1-amine (PubChem CID 142100903) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is (1Z)-N-[(4-methylphenyl)methyl]buta-1,3-dien-1-amine.
| Compound Name | (1Z)-N-[(4-methylphenyl)methyl]buta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 142100903 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | (1Z)-N-[(4-methylphenyl)methyl]buta-1,3-dien-1-amine |
| SMILES | C=C/C=C\NCc1ccc(C)cc1 |
| InChI | InChI=1S/C12H15N/c1-3-4-9-13-10-12-7-5-11(2)6-8-12/h3-9,13H,1,10H2,2H3/b9-4- |
| InChIKey | PYVKPGVUMYUDTH-WTKPLQERSA-N |
| XLogP | 2.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|