C14H17N — CID 142208313
N-[(2Z,4Z)-hepta-2,4,6-trienyl]-4-methylaniline (PubChem CID 142208313) has the molecular formula C14H17N and a molecular weight of 199.30 g/mol. Its IUPAC name is N-[(2Z,4Z)-hepta-2,4,6-trienyl]-4-methylaniline.
| Compound Name | N-[(2Z,4Z)-hepta-2,4,6-trienyl]-4-methylaniline |
|---|---|
| PubChem CID | 142208313 |
| Molecular Formula | C14H17N |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | N-[(2Z,4Z)-hepta-2,4,6-trienyl]-4-methylaniline |
| SMILES | C=C/C=C\C=C/CNc1ccc(C)cc1 |
| InChI | InChI=1S/C14H17N/c1-3-4-5-6-7-12-15-14-10-8-13(2)9-11-14/h3-11,15H,1,12H2,2H3/b5-4-,7-6- |
| InChIKey | BYORIWDRDGOWTQ-RZSVFLSASA-N |
| XLogP | 3.71 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|