C25H37N3O3S — CID 142102070
4-N-ethyl-1-N,2-dimethyl-4-N-propyl-1-N-(5-pyridin-2-ylsulfonylpent-2-ynyl)benzene-1,4-diamine;methoxymethane (PubChem CID 142102070) has the molecular formula C25H37N3O3S and a molecular weight of 459.66 g/mol. Its IUPAC name is 4-N-ethyl-1-N,2-dimethyl-4-N-propyl-1-N-(5-pyridin-2-ylsulfonylpent-2-ynyl)benzene-1,4-diamine;methoxymethane.
| Compound Name | 4-N-ethyl-1-N,2-dimethyl-4-N-propyl-1-N-(5-pyridin-2-ylsulfonylpent-2-ynyl)benzene-1,4-diamine;methoxymethane |
|---|---|
| PubChem CID | 142102070 |
| Molecular Formula | C25H37N3O3S |
| Molecular Weight | 459.66 g/mol |
| Exact Mass | 459.26 |
| IUPAC Name | 4-N-ethyl-1-N,2-dimethyl-4-N-propyl-1-N-(5-pyridin-2-ylsulfonylpent-2-ynyl)benzene-1,4-diamine;methoxymethane |
| SMILES | CCCN(CC)c1ccc(N(C)CC#CCCS(=O)(=O)c2ccccn2)c(C)c1.COC |
| InChI | InChI=1S/C23H31N3O2S.C2H6O/c1-5-16-26(6-2)21-13-14-22(20(3)19-21)25(4)17-10-7-11-18-29(27,28)23-12-8-9-15-24-23;1-3-2/h8-9,12-15,19H,5-6,11,16-18H2,1-4H3;1-2H3 |
| InChIKey | RXJIFAWCSBTKEQ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.66 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|