C17H31NO3SSn — CID 163304135
tributylstannyl pyridine-2-sulfonate (PubChem CID 163304135) has the molecular formula C17H31NO3SSn and a molecular weight of 448.22 g/mol. Its IUPAC name is tributylstannyl pyridine-2-sulfonate.
| Compound Name | tributylstannyl pyridine-2-sulfonate |
|---|---|
| PubChem CID | 163304135 |
| Molecular Formula | C17H31NO3SSn |
| Molecular Weight | 448.22 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | tributylstannyl pyridine-2-sulfonate |
| SMILES | CCCC[Sn](CCCC)(CCCC)OS(=O)(=O)c1ccccn1 |
| InChI | InChI=1S/C5H5NO3S.3C4H9.Sn/c7-10(8,9)5-3-1-2-4-6-5;3*1-3-4-2;/h1-4H,(H,7,8,9);3*1,3-4H2,2H3;/q;;;;+1/p-1 |
| InChIKey | SZXQTZDRSXDQRN-UHFFFAOYSA-M |
| XLogP | 5.13 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.22 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |