About hex-5-en-3-yl pyridine-2-sulfonate;hydrobromide
hex-5-en-3-yl pyridine-2-sulfonate;hydrobromide (PubChem CID 175437125) has the molecular formula C11H16BrNO3S
and a molecular weight of 322.22 g/mol. Its IUPAC name is hex-5-en-3-yl pyridine-2-sulfonate;hydrobromide.
Molecular Properties
| Compound Name | hex-5-en-3-yl pyridine-2-sulfonate;hydrobromide |
| PubChem CID | 175437125 |
| Molecular Formula | C11H16BrNO3S |
| Molecular Weight | 322.22 g/mol |
| Exact Mass | 321.00 |
| IUPAC Name | hex-5-en-3-yl pyridine-2-sulfonate;hydrobromide |
| SMILES | Br.C=CCC(CC)OS(=O)(=O)c1ccccn1 |
| InChI | InChI=1S/C11H15NO3S.BrH/c1-3-7-10(4-2)15-16(13,14)11-8-5-6-9-12-11;/h3,5-6,8-10H,1,4,7H2,2H3;1H |
| InChIKey | PCIOAOWVZGWEHX-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.22 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze hex-5-en-3-yl pyridine-2-sulfonate;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hex-5-en-3-yl pyridine-2-sulfonate;hydrobromide?
The IUPAC name of hex-5-en-3-yl pyridine-2-sulfonate;hydrobromide (CID 175437125) is hex-5-en-3-yl pyridine-2-sulfonate;hydrobromide.
What is the SMILES notation for hex-5-en-3-yl pyridine-2-sulfonate;hydrobromide?
The canonical SMILES for hex-5-en-3-yl pyridine-2-sulfonate;hydrobromide is Br.C=CCC(CC)OS(=O)(=O)c1ccccn1.
What is the InChIKey of hex-5-en-3-yl pyridine-2-sulfonate;hydrobromide?
The InChIKey is PCIOAOWVZGWEHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO3S.BrH/c1-3-7-10(4-2)15-16(13,14)11-8-5-6-9-12-11;/h3,5-6,8-10H,1,4,7H2,2H3;1H.
What are the key properties of hex-5-en-3-yl pyridine-2-sulfonate;hydrobromide?
hex-5-en-3-yl pyridine-2-sulfonate;hydrobromide has a molecular weight of 322.22 g/mol, XLogP of 2.72, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hex-5-en-3-yl pyridine-2-sulfonate;hydrobromide is sourced from PubChem (CID 175437125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).