C23H25NO4S — CID 132509221
(3-pentyl-5-phenylmethoxyphenyl) pyridine-2-sulfonate (PubChem CID 132509221) has the molecular formula C23H25NO4S and a molecular weight of 411.52 g/mol. Its IUPAC name is (3-pentyl-5-phenylmethoxyphenyl) pyridine-2-sulfonate.
| Compound Name | (3-pentyl-5-phenylmethoxyphenyl) pyridine-2-sulfonate |
|---|---|
| PubChem CID | 132509221 |
| Molecular Formula | C23H25NO4S |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | (3-pentyl-5-phenylmethoxyphenyl) pyridine-2-sulfonate |
| SMILES | CCCCCc1cc(OCc2ccccc2)cc(OS(=O)(=O)c2ccccn2)c1 |
| InChI | InChI=1S/C23H25NO4S/c1-2-3-5-12-20-15-21(27-18-19-10-6-4-7-11-19)17-22(16-20)28-29(25,26)23-13-8-9-14-24-23/h4,6-11,13-17H,2-3,5,12,18H2,1H3 |
| InChIKey | JEFGOPCANNLHCK-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|