C21H26N4O3S — CID 142101977
N-[4-(diethylamino)-2-methylphenyl]-N-methyl-5-pyrimidin-2-ylsulfonylpent-2-ynamide (PubChem CID 142101977) has the molecular formula C21H26N4O3S and a molecular weight of 414.53 g/mol. Its IUPAC name is N-[4-(diethylamino)-2-methylphenyl]-N-methyl-5-pyrimidin-2-ylsulfonylpent-2-ynamide.
| Compound Name | N-[4-(diethylamino)-2-methylphenyl]-N-methyl-5-pyrimidin-2-ylsulfonylpent-2-ynamide |
|---|---|
| PubChem CID | 142101977 |
| Molecular Formula | C21H26N4O3S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | N-[4-(diethylamino)-2-methylphenyl]-N-methyl-5-pyrimidin-2-ylsulfonylpent-2-ynamide |
| SMILES | CCN(CC)c1ccc(N(C)C(=O)C#CCCS(=O)(=O)c2ncccn2)c(C)c1 |
| InChI | InChI=1S/C21H26N4O3S/c1-5-25(6-2)18-11-12-19(17(3)16-18)24(4)20(26)10-7-8-15-29(27,28)21-22-13-9-14-23-21/h9,11-14,16H,5-6,8,15H2,1-4H3 |
| InChIKey | SBMOKOUPURLRTR-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 83.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|