C21H28FN — CID 142102832
1-[3-[1-(4-fluorophenyl)hexyl]phenyl]-N,N-dimethylmethanamine (PubChem CID 142102832) has the molecular formula C21H28FN and a molecular weight of 313.46 g/mol. Its IUPAC name is 1-[3-[1-(4-fluorophenyl)hexyl]phenyl]-N,N-dimethylmethanamine.
| Compound Name | 1-[3-[1-(4-fluorophenyl)hexyl]phenyl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 142102832 |
| Molecular Formula | C21H28FN |
| Molecular Weight | 313.46 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | 1-[3-[1-(4-fluorophenyl)hexyl]phenyl]-N,N-dimethylmethanamine |
| SMILES | CCCCCC(c1ccc(F)cc1)c1cccc(CN(C)C)c1 |
| InChI | InChI=1S/C21H28FN/c1-4-5-6-10-21(18-11-13-20(22)14-12-18)19-9-7-8-17(15-19)16-23(2)3/h7-9,11-15,21H,4-6,10,16H2,1-3H3 |
| InChIKey | QFJMHNMIENKIGQ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.46 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|