C17H26O — CID 142104561
5-[(Z)-but-2-en-2-yl]-3-ethenyl-6-methyl-4-[(Z)-prop-1-enyl]-2H-pyran;ethane (PubChem CID 142104561) has the molecular formula C17H26O and a molecular weight of 246.39 g/mol. Its IUPAC name is 5-[(Z)-but-2-en-2-yl]-3-ethenyl-6-methyl-4-[(Z)-prop-1-enyl]-2H-pyran;ethane.
| Compound Name | 5-[(Z)-but-2-en-2-yl]-3-ethenyl-6-methyl-4-[(Z)-prop-1-enyl]-2H-pyran;ethane |
|---|---|
| PubChem CID | 142104561 |
| Molecular Formula | C17H26O |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | 5-[(Z)-but-2-en-2-yl]-3-ethenyl-6-methyl-4-[(Z)-prop-1-enyl]-2H-pyran;ethane |
| SMILES | C=CC1=C(/C=C\C)C(/C(C)=C\C)=C(C)OC1.CC |
| InChI | InChI=1S/C15H20O.C2H6/c1-6-9-14-13(8-3)10-16-12(5)15(14)11(4)7-2;1-2/h6-9H,3,10H2,1-2,4-5H3;1-2H3/b9-6-,11-7-; |
| InChIKey | YJSZRMUZGFHXHY-ZZVGJFHUSA-N |
| XLogP | 5.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |