C23H37N3O3 — CID 142106646
1-N-(1-amino-2-hydroxy-6-methylhept-6-en-3-yl)-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide (PubChem CID 142106646) has the molecular formula C23H37N3O3 and a molecular weight of 403.57 g/mol. Its IUPAC name is 1-N-(1-amino-2-hydroxy-6-methylhept-6-en-3-yl)-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N-(1-amino-2-hydroxy-6-methylhept-6-en-3-yl)-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 142106646 |
| Molecular Formula | C23H37N3O3 |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.28 |
| IUPAC Name | 1-N-(1-amino-2-hydroxy-6-methylhept-6-en-3-yl)-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
| SMILES | C=C(C)CCC(NC(=O)c1cc(C)cc(C(=O)N(CCC)CCC)c1)C(O)CN |
| InChI | InChI=1S/C23H37N3O3/c1-6-10-26(11-7-2)23(29)19-13-17(5)12-18(14-19)22(28)25-20(21(27)15-24)9-8-16(3)4/h12-14,20-21,27H,3,6-11,15,24H2,1-2,4-5H3,(H,25,28) |
| InChIKey | URVMCXWDMYWODX-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|