C20H32N2O7 — CID 87825825
5-methyl-3-N,3-N-dipropyl-1-N-[(2S,3R)-1,3,4,5-tetrahydroxypentan-2-yl]oxybenzene-1,3-dicarboxamide (PubChem CID 87825825) has the molecular formula C20H32N2O7 and a molecular weight of 412.48 g/mol. Its IUPAC name is 5-methyl-3-N,3-N-dipropyl-1-N-[(2S,3R)-1,3,4,5-tetrahydroxypentan-2-yl]oxybenzene-1,3-dicarboxamide.
| Compound Name | 5-methyl-3-N,3-N-dipropyl-1-N-[(2S,3R)-1,3,4,5-tetrahydroxypentan-2-yl]oxybenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 87825825 |
| Molecular Formula | C20H32N2O7 |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | 5-methyl-3-N,3-N-dipropyl-1-N-[(2S,3R)-1,3,4,5-tetrahydroxypentan-2-yl]oxybenzene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cc(C)cc(C(=O)NO[C@@H](CO)[C@H](O)C(O)CO)c1 |
| InChI | InChI=1S/C20H32N2O7/c1-4-6-22(7-5-2)20(28)15-9-13(3)8-14(10-15)19(27)21-29-17(12-24)18(26)16(25)11-23/h8-10,16-18,23-26H,4-7,11-12H2,1-3H3,(H,21,27)/t16?,17-,18+/m0/s1 |
| InChIKey | GCRYHCNZKDKGFG-UQJFVLDMSA-N |
| XLogP | -0.01 |
| TPSA | 139.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|