C25H37N3O8 — CID 87826837
5-methyl-3-N,3-N-dipropyl-1-N-[(2S,3R)-2,3,4-trihydroxy-5-(pent-4-ynoylamino)oxypentoxy]benzene-1,3-dicarboxamide (PubChem CID 87826837) has the molecular formula C25H37N3O8 and a molecular weight of 507.58 g/mol. Its IUPAC name is 5-methyl-3-N,3-N-dipropyl-1-N-[(2S,3R)-2,3,4-trihydroxy-5-(pent-4-ynoylamino)oxypentoxy]benzene-1,3-dicarboxamide.
| Compound Name | 5-methyl-3-N,3-N-dipropyl-1-N-[(2S,3R)-2,3,4-trihydroxy-5-(pent-4-ynoylamino)oxypentoxy]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 87826837 |
| Molecular Formula | C25H37N3O8 |
| Molecular Weight | 507.58 g/mol |
| Exact Mass | 507.26 |
| IUPAC Name | 5-methyl-3-N,3-N-dipropyl-1-N-[(2S,3R)-2,3,4-trihydroxy-5-(pent-4-ynoylamino)oxypentoxy]benzene-1,3-dicarboxamide |
| SMILES | C#CCCC(=O)NOCC(O)[C@@H](O)[C@@H](O)CONC(=O)c1cc(C)cc(C(=O)N(CCC)CCC)c1 |
| InChI | InChI=1S/C25H37N3O8/c1-5-8-9-22(31)26-35-15-20(29)23(32)21(30)16-36-27-24(33)18-12-17(4)13-19(14-18)25(34)28(10-6-2)11-7-3/h1,12-14,20-21,23,29-30,32H,6-11,15-16H2,2-4H3,(H,26,31)(H,27,33)/t20?,21-,23+/m0/s1 |
| InChIKey | MPZZFCHULFLIEG-CBWCPMJDSA-N |
| XLogP | 0.46 |
| TPSA | 157.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.58 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|