C30H40F2N2O4 — CID 142245359
1-N-(4-but-3-ynoxy-2-hydroxybutyl)-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide;1,3-difluoro-5-methylbenzene (PubChem CID 142245359) has the molecular formula C30H40F2N2O4 and a molecular weight of 530.66 g/mol. Its IUPAC name is 1-N-(4-but-3-ynoxy-2-hydroxybutyl)-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide;1,3-difluoro-5-methylbenzene.
| Compound Name | 1-N-(4-but-3-ynoxy-2-hydroxybutyl)-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide;1,3-difluoro-5-methylbenzene |
|---|---|
| PubChem CID | 142245359 |
| Molecular Formula | C30H40F2N2O4 |
| Molecular Weight | 530.66 g/mol |
| Exact Mass | 530.30 |
| IUPAC Name | 1-N-(4-but-3-ynoxy-2-hydroxybutyl)-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide;1,3-difluoro-5-methylbenzene |
| SMILES | C#CCCOCCC(O)CNC(=O)c1cc(C)cc(C(=O)N(CCC)CCC)c1.Cc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C23H34N2O4.C7H6F2/c1-5-8-12-29-13-9-21(26)17-24-22(27)19-14-18(4)15-20(16-19)23(28)25(10-6-2)11-7-3;1-5-2-6(8)4-7(9)3-5/h1,14-16,21,26H,6-13,17H2,2-4H3,(H,24,27);2-4H,1H3 |
| InChIKey | GBHBVDNFUXCAIV-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.66 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|