C32H48F2N2O4 — CID 142245343
1,3-difluoro-5-methylbenzene;1-N-(4-hexoxy-2-hydroxybutyl)-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide (PubChem CID 142245343) has the molecular formula C32H48F2N2O4 and a molecular weight of 562.74 g/mol. Its IUPAC name is 1,3-difluoro-5-methylbenzene;1-N-(4-hexoxy-2-hydroxybutyl)-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide.
| Compound Name | 1,3-difluoro-5-methylbenzene;1-N-(4-hexoxy-2-hydroxybutyl)-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 142245343 |
| Molecular Formula | C32H48F2N2O4 |
| Molecular Weight | 562.74 g/mol |
| Exact Mass | 562.36 |
| IUPAC Name | 1,3-difluoro-5-methylbenzene;1-N-(4-hexoxy-2-hydroxybutyl)-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
| SMILES | CCCCCCOCCC(O)CNC(=O)c1cc(C)cc(C(=O)N(CCC)CCC)c1.Cc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C25H42N2O4.C7H6F2/c1-5-8-9-10-14-31-15-11-23(28)19-26-24(29)21-16-20(4)17-22(18-21)25(30)27(12-6-2)13-7-3;1-5-2-6(8)4-7(9)3-5/h16-18,23,28H,5-15,19H2,1-4H3,(H,26,29);2-4H,1H3 |
| InChIKey | PJBKLXAHYCBWAV-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.74 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|