C37H47FN2O3S — CID 142245393
3-[1-(dipropylamino)ethenyl]-N-[2-hydroxy-4-(2-phenylsulfanylethoxy)butyl]-5-methylbenzamide;1-ethynyl-3-fluoro-5-methylbenzene (PubChem CID 142245393) has the molecular formula C37H47FN2O3S and a molecular weight of 618.86 g/mol. Its IUPAC name is 3-[1-(dipropylamino)ethenyl]-N-[2-hydroxy-4-(2-phenylsulfanylethoxy)butyl]-5-methylbenzamide;1-ethynyl-3-fluoro-5-methylbenzene.
| Compound Name | 3-[1-(dipropylamino)ethenyl]-N-[2-hydroxy-4-(2-phenylsulfanylethoxy)butyl]-5-methylbenzamide;1-ethynyl-3-fluoro-5-methylbenzene |
|---|---|
| PubChem CID | 142245393 |
| Molecular Formula | C37H47FN2O3S |
| Molecular Weight | 618.86 g/mol |
| Exact Mass | 618.33 |
| IUPAC Name | 3-[1-(dipropylamino)ethenyl]-N-[2-hydroxy-4-(2-phenylsulfanylethoxy)butyl]-5-methylbenzamide;1-ethynyl-3-fluoro-5-methylbenzene |
| SMILES | C#Cc1cc(C)cc(F)c1.C=C(c1cc(C)cc(C(=O)NCC(O)CCOCCSc2ccccc2)c1)N(CCC)CCC |
| InChI | InChI=1S/C28H40N2O3S.C9H7F/c1-5-13-30(14-6-2)23(4)24-18-22(3)19-25(20-24)28(32)29-21-26(31)12-15-33-16-17-34-27-10-8-7-9-11-27;1-3-8-4-7(2)5-9(10)6-8/h7-11,18-20,26,31H,4-6,12-17,21H2,1-3H3,(H,29,32);1,4-6H,2H3 |
| InChIKey | NNEHPIKCGJIGKD-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.86 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|