C16H26N4O8 — CID 14210828
2-[(4-amino-4-carboxybutanoyl)amino]-6-(2-aminopropanoylamino)-4-methylideneheptanedioic acid (PubChem CID 14210828) has the molecular formula C16H26N4O8 and a molecular weight of 402.40 g/mol. Its IUPAC name is 2-[(4-amino-4-carboxybutanoyl)amino]-6-(2-aminopropanoylamino)-4-methylideneheptanedioic acid.
| Compound Name | 2-[(4-amino-4-carboxybutanoyl)amino]-6-(2-aminopropanoylamino)-4-methylideneheptanedioic acid |
|---|---|
| PubChem CID | 14210828 |
| Molecular Formula | C16H26N4O8 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 2-[(4-amino-4-carboxybutanoyl)amino]-6-(2-aminopropanoylamino)-4-methylideneheptanedioic acid |
| SMILES | C=C(CC(NC(=O)CCC(N)C(=O)O)C(=O)O)CC(NC(=O)C(C)N)C(=O)O |
| InChI | InChI=1S/C16H26N4O8/c1-7(6-11(16(27)28)20-13(22)8(2)17)5-10(15(25)26)19-12(21)4-3-9(18)14(23)24/h8-11H,1,3-6,17-18H2,2H3,(H,19,21)(H,20,22)(H,23,24)(H,25,26)(H,27,28) |
| InChIKey | FOTFYCDGLXIFRH-UHFFFAOYSA-N |
| XLogP | -2.00 |
| TPSA | 222.14 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|