C14H18O — CID 142109004
(2E,3Z)-2,3-di(ethylidene)-1-benzofuran;ethane (PubChem CID 142109004) has the molecular formula C14H18O and a molecular weight of 202.30 g/mol. Its IUPAC name is (2E,3Z)-2,3-di(ethylidene)-1-benzofuran;ethane.
| Compound Name | (2E,3Z)-2,3-di(ethylidene)-1-benzofuran;ethane |
|---|---|
| PubChem CID | 142109004 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | (2E,3Z)-2,3-di(ethylidene)-1-benzofuran;ethane |
| SMILES | C/C=c1\c(=C/C)oc2ccccc12.CC |
| InChI | InChI=1S/C12H12O.C2H6/c1-3-9-10-7-5-6-8-12(10)13-11(9)4-2;1-2/h3-8H,1-2H3;1-2H3/b9-3-,11-4+; |
| InChIKey | XHUSRYMKCTZFBW-BPMLPNQQSA-N |
| XLogP | 3.06 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |