C11H11ClO — CID 142112185
(1Z,3E)-1-(4-chlorophenyl)penta-1,3-dien-1-ol (PubChem CID 142112185) has the molecular formula C11H11ClO and a molecular weight of 194.66 g/mol. Its IUPAC name is (1Z,3E)-1-(4-chlorophenyl)penta-1,3-dien-1-ol.
| Compound Name | (1Z,3E)-1-(4-chlorophenyl)penta-1,3-dien-1-ol |
|---|---|
| PubChem CID | 142112185 |
| Molecular Formula | C11H11ClO |
| Molecular Weight | 194.66 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | (1Z,3E)-1-(4-chlorophenyl)penta-1,3-dien-1-ol |
| SMILES | C/C=C/C=C(\O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H11ClO/c1-2-3-4-11(13)9-5-7-10(12)8-6-9/h2-8,13H,1H3/b3-2+,11-4- |
| InChIKey | BVDXLDIXGSRPQM-ICKRUQPGSA-N |
| XLogP | 3.82 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.66 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|