C23H28ClO2+ — CID 137292672
(1E,3E)-1-(4-chlorophenyl)-4-(2,6-ditert-butylpyrylium-4-yl)buta-1,3-dien-1-ol (PubChem CID 137292672) has the molecular formula C23H28ClO2+ and a molecular weight of 371.93 g/mol. Its IUPAC name is (1E,3E)-1-(4-chlorophenyl)-4-(2,6-ditert-butylpyrylium-4-yl)buta-1,3-dien-1-ol.
| Compound Name | (1E,3E)-1-(4-chlorophenyl)-4-(2,6-ditert-butylpyrylium-4-yl)buta-1,3-dien-1-ol |
|---|---|
| PubChem CID | 137292672 |
| Molecular Formula | C23H28ClO2+ |
| Molecular Weight | 371.93 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | (1E,3E)-1-(4-chlorophenyl)-4-(2,6-ditert-butylpyrylium-4-yl)buta-1,3-dien-1-ol |
| SMILES | CC(C)(C)c1cc(/C=C/C=C(/O)c2ccc(Cl)cc2)cc(C(C)(C)C)[o+]1 |
| InChI | InChI=1S/C23H27ClO2/c1-22(2,3)20-14-16(15-21(26-20)23(4,5)6)8-7-9-19(25)17-10-12-18(24)13-11-17/h7-15H,1-6H3/p+1/b8-7+,19-9+ |
| InChIKey | GVBGACRPHCHDHQ-WKOGJKATSA-O |
| XLogP | 7.42 |
| TPSA | 31.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.93 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|