C22H26N8O — CID 142112735
N-[3-[2-amino-5-(1H-1,2,4-triazol-5-yl)benzenecarboximidoyl]phenyl]-2-(4-methylpiperazin-1-yl)acetamide (PubChem CID 142112735) has the molecular formula C22H26N8O and a molecular weight of 418.51 g/mol. Its IUPAC name is N-[3-[2-amino-5-(1H-1,2,4-triazol-5-yl)benzenecarboximidoyl]phenyl]-2-(4-methylpiperazin-1-yl)acetamide.
| Compound Name | N-[3-[2-amino-5-(1H-1,2,4-triazol-5-yl)benzenecarboximidoyl]phenyl]-2-(4-methylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 142112735 |
| Molecular Formula | C22H26N8O |
| Molecular Weight | 418.51 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | N-[3-[2-amino-5-(1H-1,2,4-triazol-5-yl)benzenecarboximidoyl]phenyl]-2-(4-methylpiperazin-1-yl)acetamide |
| SMILES | [H]/N=C(\c1cccc(NC(=O)CN2CCN(C)CC2)c1)c1cc(-c2ncn[nH]2)ccc1N |
| InChI | InChI=1S/C22H26N8O/c1-29-7-9-30(10-8-29)13-20(31)27-17-4-2-3-15(11-17)21(24)18-12-16(5-6-19(18)23)22-25-14-26-28-22/h2-6,11-12,14,24H,7-10,13,23H2,1H3,(H,27,31)(H,25,26,28)/b24-21+ |
| InChIKey | GOEUDUVKUZQYLW-DARPEHSRSA-N |
| XLogP | 1.66 |
| TPSA | 127.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.51 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|