C19H24N6O4 — CID 142117905
(1R,2R)-1-[(3R,4R)-9-amino-4-hydroxy-1-(2-phenylethyl)-3,4-dihydropurino[8,9-c][1,2,4]oxadiazin-3-yl]-2-methylpropane-1,3-diol (PubChem CID 142117905) has the molecular formula C19H24N6O4 and a molecular weight of 400.44 g/mol. Its IUPAC name is (1R,2R)-1-[(3R,4R)-9-amino-4-hydroxy-1-(2-phenylethyl)-3,4-dihydropurino[8,9-c][1,2,4]oxadiazin-3-yl]-2-methylpropane-1,3-diol.
| Compound Name | (1R,2R)-1-[(3R,4R)-9-amino-4-hydroxy-1-(2-phenylethyl)-3,4-dihydropurino[8,9-c][1,2,4]oxadiazin-3-yl]-2-methylpropane-1,3-diol |
|---|---|
| PubChem CID | 142117905 |
| Molecular Formula | C19H24N6O4 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | (1R,2R)-1-[(3R,4R)-9-amino-4-hydroxy-1-(2-phenylethyl)-3,4-dihydropurino[8,9-c][1,2,4]oxadiazin-3-yl]-2-methylpropane-1,3-diol |
| SMILES | C[C@H](CO)[C@@H](O)[C@H]1ON(CCc2ccccc2)c2nc3c(N)ncnc3n2[C@@H]1O |
| InChI | InChI=1S/C19H24N6O4/c1-11(9-26)14(27)15-18(28)25-17-13(16(20)21-10-22-17)23-19(25)24(29-15)8-7-12-5-3-2-4-6-12/h2-6,10-11,14-15,18,26-28H,7-9H2,1H3,(H2,20,21,22)/t11-,14-,15-,18-/m1/s1 |
| InChIKey | YJVOMKONJJFXCU-XKLVTHTNSA-N |
| XLogP | 0.25 |
| TPSA | 142.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |