C27H31ClN2O — CID 142119411
1-[4-[13-chloro-9-(3-methylpent-4-enyl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-yl]piperidin-1-yl]ethanone (PubChem CID 142119411) has the molecular formula C27H31ClN2O and a molecular weight of 435.01 g/mol. Its IUPAC name is 1-[4-[13-chloro-9-(3-methylpent-4-enyl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-yl]piperidin-1-yl]ethanone.
| Compound Name | 1-[4-[13-chloro-9-(3-methylpent-4-enyl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-yl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 142119411 |
| Molecular Formula | C27H31ClN2O |
| Molecular Weight | 435.01 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | 1-[4-[13-chloro-9-(3-methylpent-4-enyl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-yl]piperidin-1-yl]ethanone |
| SMILES | C=CC(C)CCC1=Cc2cc(Cl)ccc2C(C2CCN(C(C)=O)CC2)c2ncccc21 |
| InChI | InChI=1S/C27H31ClN2O/c1-4-18(2)7-8-21-16-22-17-23(28)9-10-24(22)26(27-25(21)6-5-13-29-27)20-11-14-30(15-12-20)19(3)31/h4-6,9-10,13,16-18,20,26H,1,7-8,11-12,14-15H2,2-3H3 |
| InChIKey | LBYKWKACSSNXDQ-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.01 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|