C20H27ClN2 — CID 142119425
(1Z,3Z)-6-[4-chloro-2-[(E)-prop-1-enyl]phenyl]-6-piperidin-4-ylhexa-1,3-dien-1-amine (PubChem CID 142119425) has the molecular formula C20H27ClN2 and a molecular weight of 330.90 g/mol. Its IUPAC name is (1Z,3Z)-6-[4-chloro-2-[(E)-prop-1-enyl]phenyl]-6-piperidin-4-ylhexa-1,3-dien-1-amine.
| Compound Name | (1Z,3Z)-6-[4-chloro-2-[(E)-prop-1-enyl]phenyl]-6-piperidin-4-ylhexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 142119425 |
| Molecular Formula | C20H27ClN2 |
| Molecular Weight | 330.90 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | (1Z,3Z)-6-[4-chloro-2-[(E)-prop-1-enyl]phenyl]-6-piperidin-4-ylhexa-1,3-dien-1-amine |
| SMILES | C/C=C/c1cc(Cl)ccc1C(C/C=C\C=C/N)C1CCNCC1 |
| InChI | InChI=1S/C20H27ClN2/c1-2-6-17-15-18(21)8-9-20(17)19(7-4-3-5-12-22)16-10-13-23-14-11-16/h2-6,8-9,12,15-16,19,23H,7,10-11,13-14,22H2,1H3/b4-3-,6-2+,12-5- |
| InChIKey | MPIVYLQXCQCNPU-OTZGBBCOSA-N |
| XLogP | 4.88 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.90 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|