C23H30BrClN2 — CID 142177469
(Z)-5-[2-[(E)-2-bromoethenyl]-4-chlorophenyl]-N-ethenyl-8-piperidin-4-yloct-2-en-4-imine (PubChem CID 142177469) has the molecular formula C23H30BrClN2 and a molecular weight of 449.86 g/mol. Its IUPAC name is (Z)-5-[2-[(E)-2-bromoethenyl]-4-chlorophenyl]-N-ethenyl-8-piperidin-4-yloct-2-en-4-imine.
| Compound Name | (Z)-5-[2-[(E)-2-bromoethenyl]-4-chlorophenyl]-N-ethenyl-8-piperidin-4-yloct-2-en-4-imine |
|---|---|
| PubChem CID | 142177469 |
| Molecular Formula | C23H30BrClN2 |
| Molecular Weight | 449.86 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | (Z)-5-[2-[(E)-2-bromoethenyl]-4-chlorophenyl]-N-ethenyl-8-piperidin-4-yloct-2-en-4-imine |
| SMILES | C=C/N=C(\C=C/C)C(CCCC1CCNCC1)c1ccc(Cl)cc1/C=C/Br |
| InChI | InChI=1S/C23H30BrClN2/c1-3-6-23(27-4-2)22(8-5-7-18-12-15-26-16-13-18)21-10-9-20(25)17-19(21)11-14-24/h3-4,6,9-11,14,17-18,22,26H,2,5,7-8,12-13,15-16H2,1H3/b6-3-,14-11+,27-23+ |
| InChIKey | ZNCGJAWEWIDIML-ISYOGNIKSA-N |
| XLogP | 7.12 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.86 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|